Structure of PDB 6z23 Chain A Binding Site BS01 |
|
|
Ligand ID | CEF |
InChI | InChI=1S/C14H15N5O5S2/c1-6-4-25-12(18-9(6)13(22)23)7(3-20)16-11(21)10(19-24-2)8-5-26-14(15)17-8/h3,5,7,12H,1,4H2,2H3,(H2,15,17)(H,16,21)(H,22,23)/b19-10-/t7-,12-/m1/s1 |
InChIKey | NRYMPLKBKFIWQC-YVCCLBOHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CO\N=C(/C(=O)N[C@H](C=O)[C@H]1SCC(=C)C(=N1)C(O)=O)c2csc(N)n2 | OpenEye OEToolkits 1.7.6 | CO/N=C(/c1csc(n1)N)\C(=O)NC(C=O)C2N=C(C(=C)CS2)C(=O)O | OpenEye OEToolkits 1.7.6 | CON=C(c1csc(n1)N)C(=O)NC(C=O)C2N=C(C(=C)CS2)C(=O)O | CACTVS 3.385 | CON=C(C(=O)N[CH](C=O)[CH]1SCC(=C)C(=N1)C(O)=O)c2csc(N)n2 |
|
Formula | C14 H15 N5 O5 S2 |
Name | CEFOTAXIME, C3' cleaved, open, bound form |
ChEMBL | |
DrugBank | DB08375 |
ZINC | ZINC000015605562
|
PDB chain | 6z23 Chain A Residue 308
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|