Structure of PDB 6yvy Chain A Binding Site BS01 |
|
|
Ligand ID | P1E |
InChI | InChI=1S/C19H25F3N6O2S/c1-23-31(29,30)13-9-7-12(8-10-13)25-18-24-11-14(19(20,21)22)17(27-18)26-15-5-4-6-16(15)28(2)3/h7-11,15-16,23H,4-6H2,1-3H3,(H2,24,25,26,27)/t15-,16-/m1/s1 |
InChIKey | CAUFYHKGKDJMQG-HZPDHXFCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CN[S](=O)(=O)c1ccc(Nc2ncc(c(N[C@@H]3CCC[C@H]3N(C)C)n2)C(F)(F)F)cc1 | ACDLabs 10.04 | O=S(=O)(NC)c1ccc(cc1)Nc2nc(c(cn2)C(F)(F)F)NC3CCCC3N(C)C | OpenEye OEToolkits 1.5.0 | CNS(=O)(=O)c1ccc(cc1)Nc2ncc(c(n2)NC3CCCC3N(C)C)C(F)(F)F | OpenEye OEToolkits 1.5.0 | CNS(=O)(=O)c1ccc(cc1)Nc2ncc(c(n2)N[C@@H]3CCC[C@H]3N(C)C)C(F)(F)F | CACTVS 3.341 | CN[S](=O)(=O)c1ccc(Nc2ncc(c(N[CH]3CCC[CH]3N(C)C)n2)C(F)(F)F)cc1 |
|
Formula | C19 H25 F3 N6 O2 S |
Name | 4-{[4-{[(1R,2R)-2-(dimethylamino)cyclopentyl]amino}-5-(trifluoromethyl)pyrimidin-2-yl]amino}-N-methylbenzenesulfonamide |
ChEMBL | CHEMBL509485 |
DrugBank | DB08341 |
ZINC | ZINC000040847257
|
PDB chain | 6yvy Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|