Structure of PDB 6yk4 Chain A Binding Site BS01 |
|
|
Ligand ID | CG8 |
InChI | InChI=1S/C10H14N4O4/c1-13-2-5-7(4-13)14(3-6(11)9(16)17)10(18)12-8(5)15/h6H,2-4,11H2,1H3,(H,16,17)(H,12,15,18)/t6-/m0/s1 |
InChIKey | BJXZWHLUHLDGNK-LURJTMIESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1CC2=C(C1)C(=O)NC(=O)N2C[C@H](N)C(O)=O | OpenEye OEToolkits 2.0.6 | CN1CC2=C(C1)N(C(=O)NC2=O)C[C@@H](C(=O)O)N | OpenEye OEToolkits 2.0.6 | CN1CC2=C(C1)N(C(=O)NC2=O)CC(C(=O)O)N | CACTVS 3.385 | CN1CC2=C(C1)C(=O)NC(=O)N2C[CH](N)C(O)=O |
|
Formula | C10 H14 N4 O4 |
Name | (2~{S})-2-azanyl-3-[6-methyl-2,4-bis(oxidanylidene)-5,7-dihydropyrrolo[3,4-d]pyrimidin-1-yl]propanoic acid |
ChEMBL | CHEMBL4075364 |
DrugBank | |
ZINC |
|
PDB chain | 6yk4 Chain A Residue 310
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|