Structure of PDB 6yi7 Chain A Binding Site BS01 |
|
|
Ligand ID | ORW |
InChI | InChI=1S/C17H27N5O2/c1-13(2)10-15(16(23)22(4)21(3)12-18)20-17(24)19-11-14-8-6-5-7-9-14/h5-9,12-13,15,18H,10-11H2,1-4H3,(H2,19,20,24)/b18-12-/t15-/m0/s1 |
InChIKey | DZXGVGCCLHWTMQ-BRYHAGSVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | [H]/N=C\N(C)N(C)C(=O)[C@H](CC(C)C)NC(=O)NCc1ccccc1 | CACTVS 3.385 | CC(C)C[C@H](NC(=O)NCc1ccccc1)C(=O)N(C)N(C)C=N | OpenEye OEToolkits 2.0.7 | CC(C)CC(C(=O)N(C)N(C)C=N)NC(=O)NCc1ccccc1 | CACTVS 3.385 | CC(C)C[CH](NC(=O)NCc1ccccc1)C(=O)N(C)N(C)C=N |
|
Formula | C17 H27 N5 O2 |
Name | 1-[(2~{S})-1-[[iminomethyl(methyl)amino]-methyl-amino]-4-methyl-1-oxidanylidene-pentan-2-yl]-3-(phenylmethyl)urea |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6yi7 Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|