Structure of PDB 6yg2 Chain A Binding Site BS01 |
|
|
Ligand ID | 1E8 |
InChI | InChI=1S/C25H24N6O2/c1-2-21(32)30-14-6-7-18(15-30)31-25-22(24(26)27-16-28-25)23(29-31)17-10-12-20(13-11-17)33-19-8-4-3-5-9-19/h2-5,8-13,16,18H,1,6-7,14-15H2,(H2,26,27,28)/t18-/m1/s1 |
InChIKey | XYFPWWZEPKGCCK-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Nc1ncnc2n(nc(c3ccc(Oc4ccccc4)cc3)c12)[CH]5CCCN(C5)C(=O)C=C | OpenEye OEToolkits 1.7.6 | C=CC(=O)N1CCCC(C1)n2c3c(c(n2)c4ccc(cc4)Oc5ccccc5)c(ncn3)N | ACDLabs 12.01 | n1c(c2c(nc1)n(nc2c3ccc(cc3)Oc4ccccc4)C5CCCN(C5)C(=O)\C=C)N | OpenEye OEToolkits 1.7.6 | C=CC(=O)N1CCC[C@H](C1)n2c3c(c(n2)c4ccc(cc4)Oc5ccccc5)c(ncn3)N | CACTVS 3.385 | Nc1ncnc2n(nc(c3ccc(Oc4ccccc4)cc3)c12)[C@@H]5CCCN(C5)C(=O)C=C |
|
Formula | C25 H24 N6 O2 |
Name | 1-{(3R)-3-[4-amino-3-(4-phenoxyphenyl)-1H-pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl}prop-2-en-1-one; Imbruvica; PCI-32765 |
ChEMBL | CHEMBL1873475 |
DrugBank | DB09053 |
ZINC | ZINC000035328014
|
PDB chain | 6yg2 Chain A Residue 513
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|