Structure of PDB 6ya6 Chain A Binding Site BS01 |
|
|
Ligand ID | 0SX |
InChI | InChI=1S/C14H12ClN3O2/c15-7-3-4-10-8(6-7)11-12(20-10)14(19)18-13(17-11)9-2-1-5-16-9/h3-4,6,9,16H,1-2,5H2,(H,17,18,19)/t9-/m0/s1 |
InChIKey | JJWLXRKVUJDJKG-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Clc4cc3c(oc1c3N=C(NC1=O)C2NCCC2)cc4 | OpenEye OEToolkits 1.7.6 | c1cc2c(cc1Cl)c3c(o2)C(=O)NC(=N3)[C@@H]4CCCN4 | CACTVS 3.370 | Clc1ccc2oc3C(=O)NC(=Nc3c2c1)[CH]4CCCN4 | CACTVS 3.370 | Clc1ccc2oc3C(=O)NC(=Nc3c2c1)[C@@H]4CCCN4 | OpenEye OEToolkits 1.7.6 | c1cc2c(cc1Cl)c3c(o2)C(=O)NC(=N3)C4CCCN4 |
|
Formula | C14 H12 Cl N3 O2 |
Name | 8-chloro-2-[(2S)-pyrrolidin-2-yl][1]benzofuro[3,2-d]pyrimidin-4(3H)-one |
ChEMBL | CHEMBL2030402 |
DrugBank | DB12357 |
ZINC | ZINC000084668615
|
PDB chain | 6ya6 Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|