Structure of PDB 6x3d Chain A Binding Site BS01 |
|
|
Ligand ID | ULM |
InChI | InChI=1S/C13H11F6NO2/c14-7-1-6-8(22-5-2-12(15,16)3-5)4-20-11(13(17,18)19)9(6)10(7)21/h4-5,7,10,21H,1-3H2/t7-,10-/m1/s1 |
InChIKey | PUEJLMQBKXIGPV-GMSGAONNSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O[C@@H]1[C@H](F)Cc2c(OC3CC(F)(F)C3)cnc(c12)C(F)(F)F | ACDLabs 12.01 | c1(cnc(c2c1CC(C2O)F)C(F)(F)F)OC3CC(C3)(F)F | CACTVS 3.385 | O[CH]1[CH](F)Cc2c(OC3CC(F)(F)C3)cnc(c12)C(F)(F)F | OpenEye OEToolkits 2.0.7 | c1c(c2c(c(n1)C(F)(F)F)C(C(C2)F)O)OC3CC(C3)(F)F | OpenEye OEToolkits 2.0.7 | c1c(c2c(c(n1)C(F)(F)F)[C@@H]([C@@H](C2)F)O)OC3CC(C3)(F)F |
|
Formula | C13 H11 F6 N O2 |
Name | (6R,7S)-4-[(3,3-difluorocyclobutyl)oxy]-6-fluoro-1-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[c]pyridin-7-ol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6x3d Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|