Structure of PDB 6x28 Chain A Binding Site BS01 |
|
|
Ligand ID | ULG |
InChI | InChI=1S/C16H11F5O2/c17-8-5-9(18)7-10(6-8)23-14-4-2-12(16(19,20)21)15-11(14)1-3-13(15)22/h2,4-7,13,22H,1,3H2/t13-/m1/s1 |
InChIKey | WYQNGHURDXWRST-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O[CH]1CCc2c(Oc3cc(F)cc(F)c3)ccc(c12)C(F)(F)F | OpenEye OEToolkits 2.0.7 | c1cc(c2c(c1C(F)(F)F)[C@@H](CC2)O)Oc3cc(cc(c3)F)F | CACTVS 3.385 | O[C@@H]1CCc2c(Oc3cc(F)cc(F)c3)ccc(c12)C(F)(F)F | ACDLabs 12.01 | FC(F)(F)c1ccc(c2c1C(O)CC2)Oc3cc(F)cc(c3)F | OpenEye OEToolkits 2.0.7 | c1cc(c2c(c1C(F)(F)F)C(CC2)O)Oc3cc(cc(c3)F)F |
|
Formula | C16 H11 F5 O2 |
Name | (1R)-4-(3,5-difluorophenoxy)-7-(trifluoromethyl)-2,3-dihydro-1H-inden-1-ol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6x28 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|