Structure of PDB 6we2 Chain A Binding Site BS01 |
|
|
Ligand ID | XBA |
InChI | InChI=1S/C19H23FN2O3S/c20-15-7-13(25-9-11-1-2-11)8-16-18(15)19(24)22-17(21-16)10-26-14-5-3-12(23)4-6-14/h7-8,11-12,14,23H,1-6,9-10H2,(H,21,22,24)/t12-,14- |
InChIKey | NKZDEFKPZSLQRF-MQMHXKEQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1c(cc(c2c1N=C(NC2=O)CSC3CCC(CC3)O)F)OCC4CC4 | ACDLabs 12.01 | C1CC(CCC1SCC3=Nc2cc(cc(c2C(N3)=O)F)OCC4CC4)O | CACTVS 3.385 | O[CH]1CC[CH](CC1)SCC2=Nc3cc(OCC4CC4)cc(F)c3C(=O)N2 | CACTVS 3.385 | O[C@@H]1CC[C@H](CC1)SCC2=Nc3cc(OCC4CC4)cc(F)c3C(=O)N2 |
|
Formula | C19 H23 F N2 O3 S |
Name | 7-(cyclopropylmethoxy)-5-fluoro-2-{[(trans-4-hydroxycyclohexyl)sulfanyl]methyl}quinazolin-4(3H)-one |
ChEMBL | CHEMBL5179405 |
DrugBank | |
ZINC |
|
PDB chain | 6we2 Chain A Residue 1901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|