Structure of PDB 6w0z Chain A Binding Site BS01 |
|
|
Ligand ID | S6D |
InChI | InChI=1S/C16H19F3N4O2/c1-8-2-3-23(8)15-20-12(16(17,18)19)5-13(21-15)22-6-10-9(4-14(24)25)11(10)7-22/h5,8-11H,2-4,6-7H2,1H3,(H,24,25)/t8-,9-,10-,11+/m0/s1 |
InChIKey | MDUYWDNWFXSMJJ-XWLWVQCSSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C@H]1CCN1c2nc(cc(n2)C(F)(F)F)N3C[C@@H]4[C@H](C3)C4CC(O)=O | OpenEye OEToolkits 2.0.7 | CC1CCN1c2nc(cc(n2)N3CC4C(C3)C4CC(=O)O)C(F)(F)F | OpenEye OEToolkits 2.0.7 | C[C@H]1CCN1c2nc(cc(n2)N3C[C@@H]4[C@H](C3)C4CC(=O)O)C(F)(F)F | CACTVS 3.385 | C[CH]1CCN1c2nc(cc(n2)C(F)(F)F)N3C[CH]4[CH](C3)C4CC(O)=O |
|
Formula | C16 H19 F3 N4 O2 |
Name | 2-[(1~{S},5~{R})-3-[2-[(2~{S})-2-methylazetidin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]-3-azabicyclo[3.1.0]hexan-6-yl]ethanoic acid |
ChEMBL | CHEMBL4549658 |
DrugBank | |
ZINC |
|
PDB chain | 6w0z Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|