Structure of PDB 6w0n Chain A Binding Site BS01 |
|
|
Ligand ID | RYS |
InChI | InChI=1S/C16H19F3N4O3/c1-15(26)2-3-22(8-15)14-9(5-20)10(16(17,18)19)4-13(21-14)23-6-11(24)12(25)7-23/h4,11-12,24-26H,2-3,6-8H2,1H3/t11-,12+,15-/m0/s1 |
InChIKey | FAXXYODRCHXHTQ-ZOWXZIJZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C]1(O)CCN(C1)c2nc(cc(c2C#N)C(F)(F)F)N3C[CH](O)[CH](O)C3 | CACTVS 3.385 | C[C@]1(O)CCN(C1)c2nc(cc(c2C#N)C(F)(F)F)N3C[C@H](O)[C@H](O)C3 | OpenEye OEToolkits 2.0.7 | CC1(CCN(C1)c2c(c(cc(n2)N3CC(C(C3)O)O)C(F)(F)F)C#N)O | OpenEye OEToolkits 2.0.7 | C[C@@]1(CCN(C1)c2c(c(cc(n2)N3C[C@H]([C@H](C3)O)O)C(F)(F)F)C#N)O |
|
Formula | C16 H19 F3 N4 O3 |
Name | 6-[(3~{S},4~{R})-3,4-bis(oxidanyl)pyrrolidin-1-yl]-2-[(3~{S})-3-methyl-3-oxidanyl-pyrrolidin-1-yl]-4-(trifluoromethyl)pyridine-3-carbonitrile |
ChEMBL | CHEMBL4762437 |
DrugBank | |
ZINC |
|
PDB chain | 6w0n Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|