Structure of PDB 6vv3 Chain A Binding Site BS01 |
|
|
Ligand ID | RM7 |
InChI | InChI=1S/C20H29N5OS2/c21-18-17-14-7-3-1-4-8-15(14)28-19(17)24-20(23-18)27-13-16(26)22-9-12-25-10-5-2-6-11-25/h1-13H2,(H,22,26)(H2,21,23,24) |
InChIKey | ZJUBDERDNUODTD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | C1CCc2c(sc3c2c(nc(n3)SCC(=O)NCCN4CCCCC4)N)CC1 | ACDLabs 12.01 | C(CNC(CSc1nc(N)c2c(n1)sc3c2CCCCC3)=O)N4CCCCC4 | CACTVS 3.385 | Nc1nc(SCC(=O)NCCN2CCCCC2)nc3sc4CCCCCc4c13 |
|
Formula | C20 H29 N5 O S2 |
Name | 2-[(4-amino-6,7,8,9-tetrahydro-5H-cyclohepta[4,5]thieno[2,3-d]pyrimidin-2-yl)sulfanyl]-N-[2-(piperidin-1-yl)ethyl]acetamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6vv3 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
Biological Process |
GO:0030649 |
aminoglycoside antibiotic catabolic process |
GO:0033661 |
effector-mediated defense to host-produced reactive oxygen species |
GO:0034054 |
symbiont-mediated suppression of host defense-related programmed cell death |
GO:0046677 |
response to antibiotic |
GO:0051701 |
biological process involved in interaction with host |
GO:0052032 |
symbiont-mediated perturbation of host inflammatory response |
GO:0052040 |
symbiont-mediated perturbation of host programmed cell death |
GO:0052167 |
symbiont-mediated perturbation of host innate immune response |
|
|