Structure of PDB 6vuj Chain A Binding Site BS01 |
|
|
Ligand ID | RLY |
InChI | InChI=1S/C23H30N2O5S/c1-6-25(7-2)31(27,28)18-9-10-19(17-13-23(26)24(3)15-17)20(14-18)16-8-11-21(29-4)22(12-16)30-5/h8-12,14,17H,6-7,13,15H2,1-5H3/t17-/m1/s1 |
InChIKey | CZOWHOAXNNGART-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CCN(CC)S(=O)(=O)c1ccc(c(c1)c2ccc(c(c2)OC)OC)C3CC(=O)N(C3)C | OpenEye OEToolkits 2.0.7 | CCN(CC)S(=O)(=O)c1ccc(c(c1)c2ccc(c(c2)OC)OC)[C@@H]3CC(=O)N(C3)C | ACDLabs 12.01 | c3(ccc(C1CN(C)C(C1)=O)c(c2cc(c(cc2)OC)OC)c3)S(N(CC)CC)(=O)=O | CACTVS 3.385 | CCN(CC)[S](=O)(=O)c1ccc([CH]2CN(C)C(=O)C2)c(c1)c3ccc(OC)c(OC)c3 | CACTVS 3.385 | CCN(CC)[S](=O)(=O)c1ccc([C@H]2CN(C)C(=O)C2)c(c1)c3ccc(OC)c(OC)c3 |
|
Formula | C23 H30 N2 O5 S |
Name | N,N-diethyl-3',4'-dimethoxy-6-[(3S)-1-methyl-5-oxopyrrolidin-3-yl][1,1'-biphenyl]-3-sulfonamide |
ChEMBL | CHEMBL4777253 |
DrugBank | |
ZINC |
|
PDB chain | 6vuj Chain A Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|