Structure of PDB 6vuc Chain A Binding Site BS01 |
|
|
Ligand ID | RLS |
InChI | InChI=1S/C16H22N2O3S/c1-17-12-14(11-16(17)19)13-5-7-15(8-6-13)22(20,21)18-9-3-2-4-10-18/h5-8,14H,2-4,9-12H2,1H3/t14-/m0/s1 |
InChIKey | FJZVEOQSYSYUQK-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1C[C@H](CC1=O)c2ccc(cc2)[S](=O)(=O)N3CCCCC3 | OpenEye OEToolkits 2.0.7 | CN1C[C@H](CC1=O)c2ccc(cc2)S(=O)(=O)N3CCCCC3 | ACDLabs 12.01 | CN1C(CC(C1)c2ccc(cc2)S(N3CCCCC3)(=O)=O)=O | CACTVS 3.385 | CN1C[CH](CC1=O)c2ccc(cc2)[S](=O)(=O)N3CCCCC3 | OpenEye OEToolkits 2.0.7 | CN1CC(CC1=O)c2ccc(cc2)S(=O)(=O)N3CCCCC3 |
|
Formula | C16 H22 N2 O3 S |
Name | (4R)-1-methyl-4-{4-[(piperidin-1-yl)sulfonyl]phenyl}pyrrolidin-2-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6vuc Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|