Structure of PDB 6vn8 Chain A Binding Site BS01 |
|
|
Ligand ID | 3JW |
InChI | InChI=1S/C16H17N7O2S/c1-2-26(24,25)22-9-16(10-22,4-5-17)23-8-12(7-21-23)14-13-3-6-18-15(13)20-11-19-14/h3,6-8,11H,2,4,9-10H2,1H3,(H,18,19,20) |
InChIKey | XUZMWHLSFXCVMG-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CCS(=O)(=O)N1CC(C1)(CC#N)n2cc(cn2)c3c4cc[nH]c4ncn3 | CACTVS 3.385 | CC[S](=O)(=O)N1CC(CC#N)(C1)n2cc(cn2)c3ncnc4[nH]ccc34 | ACDLabs 12.01 | O=S(=O)(N4CC(n3ncc(c2ncnc1c2ccn1)c3)(C4)CC#N)CC |
|
Formula | C16 H17 N7 O2 S |
Name | Baricitinib |
ChEMBL | CHEMBL2105759 |
DrugBank | DB11817 |
ZINC | ZINC000073069247
|
PDB chain | 6vn8 Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|