Structure of PDB 6v17 Chain A Binding Site BS01 |
|
|
Ligand ID | H1B |
InChI | InChI=1S/C22H22F3N3O3S2/c1-2-28-12-17(13-4-3-5-14(10-13)22(23,24)25)19-16(21(28)29)11-18(32-19)20(26)27-15-6-8-33(30,31)9-7-15/h3-5,10-12,15H,2,6-9H2,1H3,(H2,26,27) |
InChIKey | WRUWGLUCNBMGPS-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CCN1C=C(c2c(cc(s2)C(=NC3CCS(=O)(=O)CC3)N)C1=O)c4cccc(c4)C(F)(F)F | CACTVS 3.385 | CCN1C=C(c2cccc(c2)C(F)(F)F)c3sc(cc3C1=O)C(N)=NC4CC[S](=O)(=O)CC4 | OpenEye OEToolkits 1.7.6 | CCN1C=C(c2c(cc(s2)/C(=N/C3CCS(=O)(=O)CC3)/N)C1=O)c4cccc(c4)C(F)(F)F |
|
Formula | C22 H22 F3 N3 O3 S2 |
Name | N'-[1,1-bis(oxidanylidene)thian-4-yl]-5-ethyl-4-oxidanylidene-7-[3-(trifluoromethyl)phenyl]thieno[3,2-c]pyridine-2-carboximidamide |
ChEMBL | CHEMBL3769507 |
DrugBank | |
ZINC | ZINC000231374665
|
PDB chain | 6v17 Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|