Structure of PDB 6uyc Chain A Binding Site BS01 |
|
|
Ligand ID | QLV |
InChI | InChI=1S/C15H20F2N2O3S/c1-22-14-12(9-13(10-18-14)19-23(2,20)21)4-3-11-5-7-15(16,17)8-6-11/h3-4,9-11,19H,5-8H2,1-2H3/b4-3+ |
InChIKey | KJXYCXXAVTYSCU-ONEGZZNKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ncc(N[S](C)(=O)=O)cc1/C=C/C2CCC(F)(F)CC2 | ACDLabs 12.01 | c2(cnc(OC)c([C@H]=[C@H]C1CCC(CC1)(F)F)c2)NS(C)(=O)=O | OpenEye OEToolkits 2.0.7 | COc1c(cc(cn1)NS(=O)(=O)C)C=CC2CCC(CC2)(F)F | CACTVS 3.385 | COc1ncc(N[S](C)(=O)=O)cc1C=CC2CCC(F)(F)CC2 | OpenEye OEToolkits 2.0.7 | COc1c(cc(cn1)NS(=O)(=O)C)/C=C/C2CCC(CC2)(F)F |
|
Formula | C15 H20 F2 N2 O3 S |
Name | N-{5-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-6-methoxypyridin-3-yl}methanesulfonamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6uyc Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|