Structure of PDB 6uvv Chain A Binding Site BS01 |
|
|
Ligand ID | QJV |
InChI | InChI=1S/C14H23N3O2S/c1-2-3-4-16-12(18)10-5-11(10)14-8-19-6-9(14)7-20-13(15)17-14/h9-11H,2-8H2,1H3,(H2,15,17)(H,16,18)/t9-,10+,11+,14-/m0/s1 |
InChIKey | WVAFMFLAAGBATC-OXIWPEFWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 OpenEye OEToolkits 2.0.7 | CCCCNC(=O)[C@@H]1C[C@H]1[C@]23COC[C@H]2CSC(=N3)N | CACTVS 3.385 | CCCCNC(=O)[CH]1C[CH]1[C]23COC[CH]2CSC(=N3)N | OpenEye OEToolkits 2.0.7 | CCCCNC(=O)C1CC1C23COCC2CSC(=N3)N | ACDLabs 12.01 | O=C(C3C(C12C(CSC(=N1)N)COC2)C3)NCCCC |
|
Formula | C14 H23 N3 O2 S |
Name | (1R,2R)-2-[(4aS,7aR)-2-amino-4a,5-dihydro-4H-furo[3,4-d][1,3]thiazin-7a(7H)-yl]-N-butylcyclopropane-1-carboxamide |
ChEMBL | CHEMBL4642463 |
DrugBank | |
ZINC |
|
PDB chain | 6uvv Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|