Structure of PDB 6usw Chain A Binding Site BS01 |
|
|
Ligand ID | O51 |
InChI | InChI=1S/C15H20ClFN4O2/c16-12-4-3-11(8-13(12)17)20-14(22)10-2-1-7-21(9-10)15(23)19-6-5-18/h3-4,8,10H,1-2,5-7,9,18H2,(H,19,23)(H,20,22)/t10-/m0/s1 |
InChIKey | DOOFADZXMRBBQU-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1cc(c(cc1NC(=O)[C@H]2CCCN(C2)C(=O)NCCN)F)Cl | OpenEye OEToolkits 2.0.7 | c1cc(c(cc1NC(=O)C2CCCN(C2)C(=O)NCCN)F)Cl | CACTVS 3.385 | NCCNC(=O)N1CCC[CH](C1)C(=O)Nc2ccc(Cl)c(F)c2 | CACTVS 3.385 | NCCNC(=O)N1CCC[C@@H](C1)C(=O)Nc2ccc(Cl)c(F)c2 | ACDLabs 12.01 | C(CNC(N2CC(C(Nc1cc(F)c(Cl)cc1)=O)CCC2)=O)N |
|
Formula | C15 H20 Cl F N4 O2 |
Name | (3S)-N~1~-(2-aminoethyl)-N~3~-(4-chloro-3-fluorophenyl)piperidine-1,3-dicarboxamide |
ChEMBL | CHEMBL4450102 |
DrugBank | |
ZINC |
|
PDB chain | 6usw Chain A Residue 511
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|