Structure of PDB 6udy Chain A Binding Site BS01 |
|
|
Ligand ID | Q54 |
InChI | InChI=1S/C24H26ClNO3/c25-19-7-8-20-17(11-19)5-2-10-24(20)14-26(13-16-3-1-4-16)21-12-18(23(27)28)6-9-22(21)29-15-24/h6-9,11-12,16H,1-5,10,13-15H2,(H,27,28)/t24-/m0/s1 |
InChIKey | UZONKUOJBLOPMC-DEOSSOPVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)c1ccc2OC[C]3(CCCc4cc(Cl)ccc34)CN(CC5CCC5)c2c1 | OpenEye OEToolkits 2.0.7 | c1cc2c(cc1C(=O)O)N(C[C@@]3(CCCc4c3ccc(c4)Cl)CO2)CC5CCC5 | OpenEye OEToolkits 2.0.7 | c1cc2c(cc1C(=O)O)N(CC3(CCCc4c3ccc(c4)Cl)CO2)CC5CCC5 | CACTVS 3.385 | OC(=O)c1ccc2OC[C@]3(CCCc4cc(Cl)ccc34)CN(CC5CCC5)c2c1 | ACDLabs 12.01 | c5c(Cl)cc4CCCC2(COc1ccc(cc1N(C2)CC3CCC3)C(O)=O)c4c5 |
|
Formula | C24 H26 Cl N O3 |
Name | (3S)-6'-chloro-5-(cyclobutylmethyl)-3',4,4',5-tetrahydro-2H,2'H-spiro[1,5-benzoxazepine-3,1'-naphthalene]-7-carboxylic acid |
ChEMBL | CHEMBL4515030 |
DrugBank | |
ZINC |
|
PDB chain | 6udy Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|