Structure of PDB 6ts6 Chain A Binding Site BS01 |
|
|
Ligand ID | NW5 |
InChI | InChI=1S/C27H26N2O4/c1-27(2,16-28)21-10-17(14-32-24-6-4-3-5-19(24)13-26(30)31)9-20(11-21)18-7-8-25-22(12-18)23(29)15-33-25/h3-12,23H,13-15,29H2,1-2H3,(H,30,31)/t23-/m1/s1 |
InChIKey | SRKDCGUSWAONMJ-HSZRJFAPSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(C)(C#N)c1cc(cc(c1)c2ccc3c(c2)C(CO3)N)COc4ccccc4CC(=O)O | CACTVS 3.385 | CC(C)(C#N)c1cc(COc2ccccc2CC(O)=O)cc(c1)c3ccc4OC[CH](N)c4c3 | OpenEye OEToolkits 2.0.7 | CC(C)(C#N)c1cc(cc(c1)c2ccc3c(c2)[C@@H](CO3)N)COc4ccccc4CC(=O)O | CACTVS 3.385 | CC(C)(C#N)c1cc(COc2ccccc2CC(O)=O)cc(c1)c3ccc4OC[C@@H](N)c4c3 |
|
Formula | C27 H26 N2 O4 |
Name | 2-[2-[[3-[(3~{S})-3-azanyl-2,3-dihydro-1-benzofuran-5-yl]-5-(2-cyanopropan-2-yl)phenyl]methoxy]phenyl]ethanoic acid |
ChEMBL | CHEMBL4636415 |
DrugBank | |
ZINC |
|
PDB chain | 6ts6 Chain A Residue 307
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|