Structure of PDB 6ts5 Chain A Binding Site BS01 |
|
|
Ligand ID | NW2 |
InChI | InChI=1S/C27H29NO5/c1-16(2)19-11-17(9-10-32-26-21(27(29)30)5-4-6-25(26)31-3)12-20(13-19)18-7-8-24-22(14-18)23(28)15-33-24/h4-8,11-14,16,23H,9-10,15,28H2,1-3H3,(H,29,30)/t23-/m1/s1 |
InChIKey | KXSZMPGKDDBJRE-HSZRJFAPSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(C)c1cc(cc(c1)c2ccc3c(c2)C(CO3)N)CCOc4c(cccc4OC)C(=O)O | CACTVS 3.385 | COc1cccc(C(O)=O)c1OCCc2cc(cc(c2)c3ccc4OC[C@@H](N)c4c3)C(C)C | OpenEye OEToolkits 2.0.7 | CC(C)c1cc(cc(c1)c2ccc3c(c2)[C@@H](CO3)N)CCOc4c(cccc4OC)C(=O)O | CACTVS 3.385 | COc1cccc(C(O)=O)c1OCCc2cc(cc(c2)c3ccc4OC[CH](N)c4c3)C(C)C |
|
Formula | C27 H29 N O5 |
Name | 2-[2-[3-[(3~{S})-3-azanyl-2,3-dihydro-1-benzofuran-5-yl]-5-propan-2-yl-phenyl]ethoxy]-3-methoxy-benzoic acid |
ChEMBL | CHEMBL4646141 |
DrugBank | |
ZINC |
|
PDB chain | 6ts5 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|