Structure of PDB 6tos Chain A Binding Site BS01 |
|
|
Ligand ID | NRE |
InChI | InChI=1S/C20H23BrFN3O2/c1-13-6-8-15(11-24-18-9-7-14(21)10-23-18)25(12-13)20(26)16-4-3-5-17(22)19(16)27-2/h3-5,7,9-10,13,15H,6,8,11-12H2,1-2H3,(H,23,24)/t13-,15-/m0/s1 |
InChIKey | TWCRHJLMMAYSTE-ZFWWWQNUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC1CCC(N(C1)C(=O)c2cccc(c2OC)F)CNc3ccc(cn3)Br | CACTVS 3.385 | COc1c(F)cccc1C(=O)N2C[CH](C)CC[CH]2CNc3ccc(Br)cn3 | CACTVS 3.385 | COc1c(F)cccc1C(=O)N2C[C@@H](C)CC[C@H]2CNc3ccc(Br)cn3 | OpenEye OEToolkits 2.0.7 | C[C@H]1CC[C@H](N(C1)C(=O)c2cccc(c2OC)F)CNc3ccc(cn3)Br |
|
Formula | C20 H23 Br F N3 O2 |
Name | [(2~{S},5~{S})-2-[[(5-bromanylpyridin-2-yl)amino]methyl]-5-methyl-piperidin-1-yl]-(3-fluoranyl-2-methoxy-phenyl)methanone |
ChEMBL | CHEMBL2413522 |
DrugBank | |
ZINC | ZINC000096917227
|
PDB chain | 6tos Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|