Structure of PDB 6t6b Chain A Binding Site BS01 |
|
|
Ligand ID | MLQ |
InChI | InChI=1S/C21H22Cl2N2O4S3/c1-2-3-4-5-6-17(20(26)27)30-21-24-16-9-8-14(12-18(16)31-21)25-32(28,29)19-10-7-13(22)11-15(19)23/h7-12,17,25H,2-6H2,1H3,(H,26,27)/t17-/m1/s1 |
InChIKey | GTNKAJJMCCFDIU-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCCCCC[C@@H](Sc1sc2cc(N[S](=O)(=O)c3ccc(Cl)cc3Cl)ccc2n1)C(O)=O | CACTVS 3.385 | CCCCCC[CH](Sc1sc2cc(N[S](=O)(=O)c3ccc(Cl)cc3Cl)ccc2n1)C(O)=O | OpenEye OEToolkits 2.0.7 | CCCCCCC(C(=O)O)Sc1nc2ccc(cc2s1)NS(=O)(=O)c3ccc(cc3Cl)Cl | OpenEye OEToolkits 2.0.7 | CCCCCC[C@H](C(=O)O)Sc1nc2ccc(cc2s1)NS(=O)(=O)c3ccc(cc3Cl)Cl |
|
Formula | C21 H22 Cl2 N2 O4 S3 |
Name | (2~{R})-2-[[6-[(2,4-dichlorophenyl)sulfonylamino]-1,3-benzothiazol-2-yl]sulfanyl]octanoic acid |
ChEMBL | CHEMBL4445084 |
DrugBank | |
ZINC |
|
PDB chain | 6t6b Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|