Structure of PDB 6sfh Chain A Binding Site BS01 |
|
|
Ligand ID | L9Z |
InChI | InChI=1S/C8H15NO5/c9-3-8(14)2-4(7(12)13)1-5(10)6(8)11/h4-6,10-11,14H,1-3,9H2,(H,12,13)/t4-,5+,6-,8-/m0/s1 |
InChIKey | YNLZKDMNCIPLRS-GCJQMDKQSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NC[C@@]1(O)C[C@H](C[C@@H](O)[C@@H]1O)C(O)=O | OpenEye OEToolkits 2.0.7 | C1C(CC(C(C1O)O)(CN)O)C(=O)O | OpenEye OEToolkits 2.0.7 | C1[C@@H](C[C@@]([C@H]([C@@H]1O)O)(CN)O)C(=O)O | CACTVS 3.385 | NC[C]1(O)C[CH](C[CH](O)[CH]1O)C(O)=O |
|
Formula | C8 H15 N O5 |
Name | (1~{S},3~{S},4~{S},5~{R})-3-(aminomethyl)-3,4,5-tris(hydroxyl)cyclohexane-1-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6sfh Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
Q74 H133 K160 |
Catalytic site (residue number reindexed from 1) |
Q73 H132 K159 |
Enzyme Commision number |
4.2.1.10: 3-dehydroquinate dehydratase. |
|
|
|