Structure of PDB 6sbo Chain A Binding Site BS01 |
|
|
Ligand ID | L5B |
InChI | InChI=1S/C31H30Cl2FNO3/c32-23-8-12-27(29(33)18-23)28-4-1-3-21-17-22(31(36)37)7-11-26(21)30(28)20-5-9-24(10-6-20)38-25-13-16-35(19-25)15-2-14-34/h5-12,17-18,25H,1-4,13-16,19H2,(H,36,37)/t25-/m0/s1 |
InChIKey | KISZAGQTIXIVAR-VWLOTQADSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1cc(ccc1C2=C(CCCc3c2ccc(c3)C(=O)O)c4ccc(cc4Cl)Cl)OC5CCN(C5)CCCF | CACTVS 3.385 | OC(=O)c1ccc2c(CCCC(=C2c3ccc(O[CH]4CCN(CCCF)C4)cc3)c5ccc(Cl)cc5Cl)c1 | OpenEye OEToolkits 2.0.7 | c1cc(ccc1C2=C(CCCc3c2ccc(c3)C(=O)O)c4ccc(cc4Cl)Cl)O[C@H]5CCN(C5)CCCF | CACTVS 3.385 | OC(=O)c1ccc2c(CCCC(=C2c3ccc(O[C@H]4CCN(CCCF)C4)cc3)c5ccc(Cl)cc5Cl)c1 |
|
Formula | C31 H30 Cl2 F N O3 |
Name | 6-(2,4-dichlorophenyl)-5-[4-[(3~{S})-1-(3-fluoranylpropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7~{H}-benzo[7]annulene-2-carboxylic acid |
ChEMBL | CHEMBL4475463 |
DrugBank | |
ZINC |
|
PDB chain | 6sbo Chain A Residue 4000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
Global view | Local view | Structure summary |
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
PDB | 6sbo Discovery of 6-(2,4-Dichlorophenyl)-5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid (SAR439859), a Potent and Selective Estrogen Receptor Degrader (SERD) for the Treatment of Estrogen-Receptor-Positive Breast Cancer. |
Resolution | 1.48 Å |
Binding residue (original residue number in PDB) | M343 T347 L349 A350 D351 E353 W383 L384 F404 M421 I424 G521 L525 V533 V534 P535 L539 |
Binding residue (residue number reindexed from 1) | M32 T36 L38 A39 D40 E42 W72 L73 F93 M110 I113 G210 L214 V222 V223 P224 L228 |
Annotation score | 1 |
Binding affinity | BindingDB: IC50=15.0nM,EC50=0.200000nM |
|
|
Enzyme Commision number |
? |
|
|