Structure of PDB 6s4n Chain A Binding Site BS01 |
|
|
Ligand ID | KUW |
InChI | InChI=1S/C24H27ClN4O5S/c1-15(2)29-24(32)21(22(35(29,33)34)17-6-4-3-5-7-17)27-18-8-10-28(11-9-18)23-19(25)12-16(14-26-23)13-20(30)31/h3-7,12,14-15,18,27H,8-11,13H2,1-2H3,(H,30,31) |
InChIKey | JSAUQHYJLCPNIF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)N1C(=O)C(=C(c2ccccc2)[S]1(=O)=O)NC3CCN(CC3)c4ncc(CC(O)=O)cc4Cl | OpenEye OEToolkits 2.0.7 | CC(C)N1C(=O)C(=C(S1(=O)=O)c2ccccc2)NC3CCN(CC3)c4c(cc(cn4)CC(=O)O)Cl |
|
Formula | C24 H27 Cl N4 O5 S |
Name | 2-[5-chloranyl-6-[4-[[1,1,3-tris(oxidanylidene)-5-phenyl-2-propan-2-yl-1,2-thiazol-4-yl]amino]piperidin-1-yl]pyridin-3-yl]ethanoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6s4n Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|