Structure of PDB 6qr3 Chain A Binding Site BS01 |
|
|
Ligand ID | JE8 |
InChI | InChI=1S/C19H22N6/c1-24-7-2-3-13(11-24)12-25-8-6-14-4-5-15(9-17(14)25)18-16(10-20)19(21)23-22-18/h4-6,8-9,13H,2-3,7,11-12H2,1H3,(H3,21,22,23)/t13-/m0/s1 |
InChIKey | AJRDTQMINSKQOE-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1CCC[CH](C1)Cn2ccc3ccc(cc23)c4n[nH]c(N)c4C#N | CACTVS 3.385 | CN1CCC[C@@H](C1)Cn2ccc3ccc(cc23)c4n[nH]c(N)c4C#N | OpenEye OEToolkits 2.0.7 | CN1CCCC(C1)Cn2ccc3c2cc(cc3)c4c(c([nH]n4)N)C#N | OpenEye OEToolkits 2.0.7 | CN1CCC[C@@H](C1)Cn2ccc3c2cc(cc3)c4c(c([nH]n4)N)C#N |
|
Formula | C19 H22 N6 |
Name | 5-azanyl-3-[1-[[(3~{S})-1-methylpiperidin-3-yl]methyl]indol-6-yl]-1~{H}-pyrazole-4-carbonitrile |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6qr3 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
P85 E112 R154 |
Catalytic site (residue number reindexed from 1) |
P86 E113 R155 |
Enzyme Commision number |
2.1.1.228: tRNA (guanine(37)-N(1))-methyltransferase. |
|
|
|