Structure of PDB 6qef Chain A Binding Site BS01 |
|
|
Ligand ID | HZW |
InChI | InChI=1S/C18H16ClFN2O3/c19-13-8-12(9-14(20)10-13)11-21-16(23)18(25)6-7-22(17(18)24)15-4-2-1-3-5-15/h1-5,8-10,25H,6-7,11H2,(H,21,23)/t18-/m0/s1 |
InChIKey | GYXUHDDOWYYRFT-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O[C]1(CCN(C1=O)c2ccccc2)C(=O)NCc3cc(F)cc(Cl)c3 | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)N2CCC(C2=O)(C(=O)NCc3cc(cc(c3)Cl)F)O | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)N2CC[C@@](C2=O)(C(=O)NCc3cc(cc(c3)Cl)F)O | CACTVS 3.385 | O[C@@]1(CCN(C1=O)c2ccccc2)C(=O)NCc3cc(F)cc(Cl)c3 |
|
Formula | C18 H16 Cl F N2 O3 |
Name | (3~{S})-~{N}-[(3-chloranyl-5-fluoranyl-phenyl)methyl]-3-oxidanyl-2-oxidanylidene-1-phenyl-pyrrolidine-3-carboxamide |
ChEMBL | CHEMBL4552396 |
DrugBank | |
ZINC |
|
PDB chain | 6qef Chain A Residue 507
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|