Structure of PDB 6q6m Chain A Binding Site BS01 |
|
|
Ligand ID | HJW |
InChI | InChI=1S/C17H18ClNO3S/c1-4-22-17(21)12(3)19(16(20)14-9-6-10-23-14)15-11(2)7-5-8-13(15)18/h5-10,12H,4H2,1-3H3/t12-/m0/s1 |
InChIKey | XYAGVCFCNDDPMS-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCOC(=O)C(C)N(c1c(cccc1Cl)C)C(=O)c2cccs2 | CACTVS 3.385 | CCOC(=O)[C@H](C)N(C(=O)c1sccc1)c2c(C)cccc2Cl | OpenEye OEToolkits 2.0.6 | CCOC(=O)[C@H](C)N(c1c(cccc1Cl)C)C(=O)c2cccs2 | CACTVS 3.385 | CCOC(=O)[CH](C)N(C(=O)c1sccc1)c2c(C)cccc2Cl |
|
Formula | C17 H18 Cl N O3 S |
Name | ethyl (2~{S})-2-[(2-chloranyl-6-methyl-phenyl)-thiophen-2-ylcarbonyl-amino]propanoate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6q6m Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|