Structure of PDB 6pyb Chain A Binding Site BS01 |
|
|
Ligand ID | P5G |
InChI | InChI=1S/C20H24O5/c1-23-19-9-13(3-5-17(19)21)7-15-11-25-12-16(15)8-14-4-6-18(22)20(10-14)24-2/h3-6,9-10,15-16,21-22H,7-8,11-12H2,1-2H3/t15-,16-/m0/s1 |
InChIKey | ROGUIJKVZZROIQ-HOTGVXAUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | COc1cc(ccc1O)C[C@H]2COC[C@@H]2Cc3ccc(c(c3)OC)O | ACDLabs 12.01 | c1(ccc(O)c(c1)OC)CC2COCC2Cc3cc(c(cc3)O)OC | CACTVS 3.385 | COc1cc(C[CH]2COC[CH]2Cc3ccc(O)c(OC)c3)ccc1O | OpenEye OEToolkits 2.0.7 | COc1cc(ccc1O)CC2COCC2Cc3ccc(c(c3)OC)O | CACTVS 3.385 | COc1cc(C[C@H]2COC[C@@H]2Cc3ccc(O)c(OC)c3)ccc1O |
|
Formula | C20 H24 O5 |
Name | 4,4'-[(3R,4R)-oxolane-3,4-diylbis(methylene)]bis(2-methoxyphenol) |
ChEMBL | CHEMBL367448 |
DrugBank | |
ZINC | ZINC000005999108
|
PDB chain | 6pyb Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|