Structure of PDB 6pvd Chain A Binding Site BS01 |
|
|
Ligand ID | N18 |
InChI | InChI=1S/C9H11N3O5/c1-17-7(14)2-3-10-8(15)5-4-6(13)12-9(16)11-5/h4H,2-3H2,1H3,(H,10,15)(H2,11,12,13,16) |
InChIKey | OQKCUQQTEDLJJP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 OpenEye OEToolkits 2.0.7 | COC(=O)CCNC(=O)C1=CC(=O)NC(=O)N1 | ACDLabs 12.01 | N(CCC(OC)=O)C(C=1NC(=O)NC(C=1)=O)=O |
|
Formula | C9 H11 N3 O5 |
Name | methyl N-(2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carbonyl)-beta-alaninate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6pvd Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|