Structure of PDB 6pui Chain A Binding Site BS01 |
|
|
Ligand ID | Q7P |
InChI | InChI=1S/C11H16N4O4/c1-7(17)6-13-8-9(12-4-2-3-5-16)14-11(19)15-10(8)18/h6,16H,2-5H2,1H3,(H3,12,14,15,18,19)/b13-6+ |
InChIKey | OCPAQIZKGXRILZ-AWNIVKPZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(=O)C=NC1=C(NCCCCO)NC(=O)NC1=O | OpenEye OEToolkits 2.0.7 | CC(=O)C=NC1=C(NC(=O)NC1=O)NCCCCO | OpenEye OEToolkits 2.0.7 | CC(=O)/C=N/C1=C(NC(=O)NC1=O)NCCCCO | ACDLabs 12.01 | C1(NC(=O)C(/N=C/C(C)=O)=C(NCCCCO)N1)=O |
|
Formula | C11 H16 N4 O4 |
Name | 6-[(4-hydroxybutyl)amino]-5-[(E)-(2-oxopropylidene)amino]pyrimidine-2,4(1H,3H)-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6pui Chain A Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|