Structure of PDB 6pug Chain A Binding Site BS01 |
|
|
Ligand ID | OZD |
InChI | InChI=1S/C9H12N4O4/c1-5(15)4-11-6-7(10-2-3-14)12-9(17)13-8(6)16/h4,14H,2-3H2,1H3,(H3,10,12,13,16,17)/b11-4+ |
InChIKey | HVWXIWYEXZLAAS-NYYWCZLTSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(=O)/C=N/C1=C(NC(=O)NC1=O)NCCO | CACTVS 3.385 | CC(=O)C=NC1=C(NCCO)NC(=O)NC1=O | ACDLabs 12.01 | C(CO)NC=1NC(=O)NC(C=1\N=C\C(C)=O)=O | OpenEye OEToolkits 2.0.7 | CC(=O)C=NC1=C(NC(=O)NC1=O)NCCO |
|
Formula | C9 H12 N4 O4 |
Name | 6-[(2-hydroxyethyl)amino]-5-[(E)-(2-oxopropylidene)amino]pyrimidine-2,4(1H,3H)-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6pug Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|