Structure of PDB 6pud Chain A Binding Site BS01 |
|
|
Ligand ID | OYD |
InChI | InChI=1S/C12H20N4O3/c1-2-6-13-9-10(14-7-4-3-5-8-17)15-12(19)16-11(9)18/h6,17H,2-5,7-8H2,1H3,(H3,14,15,16,18,19)/b13-6+ |
InChIKey | ZKFUQHLXTDAXLG-AWNIVKPZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCC=NC1=C(NCCCCCO)NC(=O)NC1=O | OpenEye OEToolkits 2.0.7 | CCC=NC1=C(NC(=O)NC1=O)NCCCCCO | OpenEye OEToolkits 2.0.7 | CC/C=N/C1=C(NC(=O)NC1=O)NCCCCCO | ACDLabs 12.01 | C=1(NCCCCCO)NC(NC(C=1N=[C@H]CC)=O)=O |
|
Formula | C12 H20 N4 O3 |
Name | 6-[(5-hydroxypentyl)amino]-5-[(E)-propylideneamino]pyrimidine-2,4(1H,3H)-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6pud Chain A Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|