Structure of PDB 6pgb Chain A Binding Site BS01 |
|
|
Ligand ID | OJG |
InChI | InChI=1S/C16H21N3O2/c20-12-14-11-18-15(19-14)8-4-5-9-17-16(21)10-13-6-2-1-3-7-13/h1-3,6-7,11,20H,4-5,8-10,12H2,(H,17,21)(H,18,19) |
InChIKey | NWJHGXOXPDGAJH-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc(cc1)CC(=O)NCCCCc2[nH]c(cn2)CO | ACDLabs 12.01 | C(CNC(=O)Cc1ccccc1)CCc2ncc(CO)n2 | CACTVS 3.385 | OCc1[nH]c(CCCCNC(=O)Cc2ccccc2)nc1 |
|
Formula | C16 H21 N3 O2 |
Name | N-{4-[5-(hydroxymethyl)-1H-imidazol-2-yl]butyl}-2-phenylacetamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6pgb Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|