Structure of PDB 6pg9 Chain A Binding Site BS01 |
|
|
Ligand ID | OH1 |
InChI | InChI=1S/C15H19N3O2/c19-11-13-10-17-14(18-13)8-4-5-9-16-15(20)12-6-2-1-3-7-12/h1-3,6-7,10,19H,4-5,8-9,11H2,(H,16,20)(H,17,18) |
InChIKey | JCUWYBMNDMMIAC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc(cc1)C(=O)NCCCCc2[nH]cc(n2)CO | CACTVS 3.385 | OCc1c[nH]c(CCCCNC(=O)c2ccccc2)n1 | ACDLabs 12.01 | C(NC(c1ccccc1)=O)CCCc2ncc(CO)n2 |
|
Formula | C15 H19 N3 O2 |
Name | N-{4-[4-(hydroxymethyl)-1H-imidazol-2-yl]butyl}benzamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6pg9 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|