Structure of PDB 6pd7 Chain A Binding Site BS01 |
|
|
Ligand ID | OAJ |
InChI | InChI=1S/C21H20N2O5/c1-14-10-18(7-4-16(14)12-22)28-17-5-2-15(3-6-17)11-20(24)23-8-9-27-13-19(23)21(25)26/h2-7,10,19H,8-9,11,13H2,1H3,(H,25,26)/t19-/m1/s1 |
InChIKey | AJUGJYIFDAVOIF-LJQANCHMSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1cc(Oc2ccc(CC(=O)N3CCOC[C@@H]3C(O)=O)cc2)ccc1C#N | ACDLabs 12.01 | OC(C1COCCN1C(Cc2ccc(cc2)Oc3cc(C)c(cc3)C#N)=O)=O | OpenEye OEToolkits 2.0.7 | Cc1cc(ccc1C#N)Oc2ccc(cc2)CC(=O)N3CCOC[C@@H]3C(=O)O | CACTVS 3.385 | Cc1cc(Oc2ccc(CC(=O)N3CCOC[CH]3C(O)=O)cc2)ccc1C#N | OpenEye OEToolkits 2.0.7 | Cc1cc(ccc1C#N)Oc2ccc(cc2)CC(=O)N3CCOCC3C(=O)O |
|
Formula | C21 H20 N2 O5 |
Name | (3R)-4-{[4-(4-cyano-3-methylphenoxy)phenyl]acetyl}morpholine-3-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6pd7 Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|