Structure of PDB 6p3t Chain A Binding Site BS01 |
|
|
Ligand ID | NRS |
InChI | InChI=1S/C19H15N3O4S/c1-22(14-7-6-12-4-2-3-5-13(12)10-14)27(25,26)15-8-9-16-17(11-15)21-19(24)18(23)20-16/h2-11H,1H3,(H,20,23)(H,21,24) |
InChIKey | HSAXTPZNMSIOAI-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CN(c1ccc2ccccc2c1)S(=O)(=O)c3ccc4c(c3)NC(=O)C(=O)N4 | CACTVS 3.385 | CN(c1ccc2ccccc2c1)[S](=O)(=O)c3ccc4NC(=O)C(=O)Nc4c3 | ACDLabs 12.01 | O=S(c1ccc2c(c1)NC(C(N2)=O)=O)(N(C)c3ccc4c(c3)cccc4)=O |
|
Formula | C19 H15 N3 O4 S |
Name | N-methyl-N-(naphthalen-2-yl)-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonamide |
ChEMBL | CHEMBL3931964 |
DrugBank | |
ZINC |
|
PDB chain | 6p3t Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
Biological Process |
GO:0030649 |
aminoglycoside antibiotic catabolic process |
GO:0033661 |
effector-mediated defense to host-produced reactive oxygen species |
GO:0034054 |
symbiont-mediated suppression of host defense-related programmed cell death |
GO:0046677 |
response to antibiotic |
GO:0051701 |
biological process involved in interaction with host |
GO:0052032 |
symbiont-mediated perturbation of host inflammatory response |
GO:0052040 |
symbiont-mediated perturbation of host programmed cell death |
GO:0052167 |
symbiont-mediated perturbation of host innate immune response |
|
|