Structure of PDB 6ova Chain A Binding Site BS01 |
|
|
Ligand ID | N9G |
InChI | InChI=1S/C21H22N6O2/c1-26(2)19(28)14-3-6-17(24-12-14)25-18-11-16(7-9-23-18)27-10-8-21(13-22,20(27)29)15-4-5-15/h3,6-7,9,11-12,15H,4-5,8,10H2,1-2H3,(H,23,24,25)/t21-/m1/s1 |
InChIKey | CFHPNFDEUWSEIR-OAQYLSRUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN(C)C(=O)c1ccc(Nc2cc(ccn2)N3CC[C@@](C#N)(C4CC4)C3=O)nc1 | ACDLabs 12.01 | C(N(C)C)(c1ccc(nc1)Nc4cc(N3C(C(C2CC2)(C#N)CC3)=O)ccn4)=O | OpenEye OEToolkits 2.0.7 | CN(C)C(=O)c1ccc(nc1)Nc2cc(ccn2)N3CCC(C3=O)(C#N)C4CC4 | CACTVS 3.385 | CN(C)C(=O)c1ccc(Nc2cc(ccn2)N3CC[C](C#N)(C4CC4)C3=O)nc1 | OpenEye OEToolkits 2.0.7 | CN(C)C(=O)c1ccc(nc1)Nc2cc(ccn2)N3CC[C@@](C3=O)(C#N)C4CC4 |
|
Formula | C21 H22 N6 O2 |
Name | 6-({4-[(3S)-3-cyano-3-cyclopropyl-2-oxopyrrolidin-1-yl]pyridin-2-yl}amino)-N,N-dimethylpyridine-3-carboxamide |
ChEMBL | CHEMBL4636795 |
DrugBank | |
ZINC |
|
PDB chain | 6ova Chain A Residue 1200
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|