Structure of PDB 6os6 Chain A Binding Site BS01 |
|
|
Ligand ID | DST |
InChI | InChI=1S/C5H12O6P2S/c1-5(2)3-4-14-13(9,10)11-12(6,7)8/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8) |
InChIKey | ZWFWSISPSBLNGO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(=CCSP(=O)(O)OP(=O)(O)O)C | OpenEye OEToolkits 2.0.7 | CC(=CCS[P@@](=O)(O)OP(=O)(O)O)C | ACDLabs 12.01 | OP(O)(=O)OP(O)(=O)SC\C=C(\C)C | CACTVS 3.385 | CC(C)=CCS[P](O)(=O)O[P](O)(O)=O |
|
Formula | C5 H12 O6 P2 S |
Name | DIMETHYLALLYL S-THIOLODIPHOSPHATE; DMASPP; DMAPP; DMADP; Dimethylallyl pyrophosphate; dimethylallyl diphosphate; isoprenyl pyrophosphate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6os6 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|