Structure of PDB 6onf Chain A Binding Site BS01 |
|
|
Ligand ID | MW4 |
InChI | InChI=1S/C15H18ClFN2O3/c1-2-22-15(21)19-7-3-4-10(9-19)14(20)18-11-5-6-12(16)13(17)8-11/h5-6,8,10H,2-4,7,9H2,1H3,(H,18,20)/t10-/m0/s1 |
InChIKey | WBCXRKGXRIKPBA-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CCOC(=O)N1CCC[C@@H](C1)C(=O)Nc2ccc(c(c2)F)Cl | ACDLabs 12.01 | c1c(ccc(c1F)Cl)NC(C2CCCN(C(OCC)=O)C2)=O | OpenEye OEToolkits 2.0.7 | CCOC(=O)N1CCCC(C1)C(=O)Nc2ccc(c(c2)F)Cl | CACTVS 3.385 | CCOC(=O)N1CCC[CH](C1)C(=O)Nc2ccc(Cl)c(F)c2 | CACTVS 3.385 | CCOC(=O)N1CCC[C@@H](C1)C(=O)Nc2ccc(Cl)c(F)c2 |
|
Formula | C15 H18 Cl F N2 O3 |
Name | ethyl (3S)-3-[(4-chloro-3-fluorophenyl)carbamoyl]piperidine-1-carboxylate |
ChEMBL | CHEMBL4514380 |
DrugBank | |
ZINC |
|
PDB chain | 6onf Chain A Residue 511
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|