Structure of PDB 6ofw Chain A Binding Site BS01 |
|
|
Ligand ID | 22D |
InChI | InChI=1S/C14H12N6O3/c15-14-19-11-10(12(21)20-14)18-9(6-17-11)5-16-8-3-1-7(2-4-8)13(22)23/h1-4,6,16H,5H2,(H,22,23)(H3,15,17,19,20,21) |
InChIKey | JOAQINSXLLMRCV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(ccc1C(=O)O)NCc2cnc3c(n2)C(=O)NC(=N3)N | CACTVS 3.385 | NC1=Nc2ncc(CNc3ccc(cc3)C(O)=O)nc2C(=O)N1 | ACDLabs 12.01 | O=C(O)c1ccc(cc1)NCc3nc2c(N=C(N)NC2=O)nc3 |
|
Formula | C14 H12 N6 O3 |
Name | 4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoic acid |
ChEMBL | CHEMBL341824 |
DrugBank | DB04196 |
ZINC | ZINC000006628789
|
PDB chain | 6ofw Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.5.1.15: dihydropteroate synthase. |
|
|
|