Structure of PDB 6o68 Chain A Binding Site BS01 |
|
|
Ligand ID | LO4 |
InChI | InChI=1S/C18H23NO3S/c1-18(9-3-2-4-10-18)12-22-14-7-5-13(6-8-14)11-15-16(20)19-17(21)23-15/h5-8,23H,2-4,9-12H2,1H3,(H,19,20,21) |
InChIKey | VYHNBSGGAFFFLO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC1(CCCCC1)COc2ccc(cc2)CC3=SC(=O)NC3=O | ACDLabs 12.01 | c2(OCC1(C)CCCCC1)ccc(cc2)CC=3C(NC(=O)S=3)=O | CACTVS 3.385 | CC1(CCCCC1)COc2ccc(CC3=[SH]C(=O)NC3=O)cc2 |
|
Formula | C18 H23 N O3 S |
Name | Ciglitazone; 5-({4-[(1-methylcyclohexyl)methoxy]phenyl}methyl)-2H-1lambda~4~,3-thiazole-2,4(3H)-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6o68 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|