Structure of PDB 6o67 Chain A Binding Site BS01 |
|
|
Ligand ID | LO7 |
InChI | InChI=1S/C19H18N2O4S/c1-2-12-5-8-15(20-10-12)16(22)11-25-14-6-3-13(4-7-14)9-17-18(23)21-19(24)26-17/h3-8,10,17H,2,9,11H2,1H3,(H,21,23,24)/t17-/m0/s1 |
InChIKey | IRNJSRAGRIZIHD-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCc1ccc(nc1)C(=O)COc2ccc(C[CH]3SC(=O)NC3=O)cc2 | OpenEye OEToolkits 2.0.7 | CCc1ccc(nc1)C(=O)COc2ccc(cc2)C[C@H]3C(=O)NC(=O)S3 | CACTVS 3.385 | CCc1ccc(nc1)C(=O)COc2ccc(C[C@@H]3SC(=O)NC3=O)cc2 | ACDLabs 12.01 | c2(OCC(c1ccc(CC)cn1)=O)ccc(cc2)CC3SC(=O)NC3=O | OpenEye OEToolkits 2.0.7 | CCc1ccc(nc1)C(=O)COc2ccc(cc2)CC3C(=O)NC(=O)S3 |
|
Formula | C19 H18 N2 O4 S |
Name | Mitoglitazone; (5S)-5-({4-[2-(5-ethylpyridin-2-yl)-2-oxoethoxy]phenyl}methyl)-1,3-thiazolidine-2,4-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000001482950
|
PDB chain | 6o67 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|