Structure of PDB 6nwu Chain A Binding Site BS01 |
|
|
Ligand ID | L7J |
InChI | InChI=1S/C21H15Cl2F3N2O3S/c22-18-10-27-11-19(23)17(18)12-31-15-5-4-13-6-7-28(20(13)9-15)32(29,30)16-3-1-2-14(8-16)21(24,25)26/h1-5,8-11H,6-7,12H2 |
InChIKey | PXLLMOZEQWSZPR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | FC(F)(F)c1cccc(c1)[S](=O)(=O)N2CCc3ccc(OCc4c(Cl)cncc4Cl)cc23 | ACDLabs 12.01 | c1(cc(ccc1)C(F)(F)F)S(N3CCc2ccc(cc23)OCc4c(cncc4Cl)Cl)(=O)=O | OpenEye OEToolkits 2.0.7 | c1cc(cc(c1)S(=O)(=O)N2CCc3c2cc(cc3)OCc4c(cncc4Cl)Cl)C(F)(F)F |
|
Formula | C21 H15 Cl2 F3 N2 O3 S |
Name | 6-[(3,5-dichloropyridin-4-yl)methoxy]-1-{[3-(trifluoromethyl)phenyl]sulfonyl}-2,3-dihydro-1H-indole |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6nwu Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|