Structure of PDB 6n8y Chain A Binding Site BS01 |
|
|
Ligand ID | KFY |
InChI | InChI=1S/C19H23N5O3/c1-5-6-7-24-15(23-16-18(20)21-11-22-19(16)24)10-12-8-13(25-2)17(27-4)14(9-12)26-3/h5-6,8-9,11H,7,10H2,1-4H3,(H2,20,21,22)/b6-5+ |
InChIKey | ZAFMHPQRCYVTLV-AATRIKPKSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c12ncnc(c1nc(n2C\C=C\C)Cc3cc(OC)c(OC)c(c3)OC)N | OpenEye OEToolkits 2.0.6 | C/C=C/Cn1c(nc2c1ncnc2N)Cc3cc(c(c(c3)OC)OC)OC | CACTVS 3.385 | COc1cc(Cc2nc3c(N)ncnc3n2CC=CC)cc(OC)c1OC | CACTVS 3.385 | COc1cc(Cc2nc3c(N)ncnc3n2C/C=C/C)cc(OC)c1OC | OpenEye OEToolkits 2.0.6 | CC=CCn1c(nc2c1ncnc2N)Cc3cc(c(c(c3)OC)OC)OC |
|
Formula | C19 H23 N5 O3 |
Name | 9-[(2E)-but-2-en-1-yl]-8-[(3,4,5-trimethoxyphenyl)methyl]-9H-purin-6-amine |
ChEMBL | CHEMBL350813 |
DrugBank | |
ZINC | ZINC000013839107
|
PDB chain | 6n8y Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|