Structure of PDB 6mzw Chain A Binding Site BS01 |
|
|
Ligand ID | TZ0 |
InChI | InChI=1S/C22H22N6O3/c1-4-19(29)27-8-7-15(12-27)28-22-20(21(23)24-13-25-22)18(26-28)6-5-14-9-16(30-2)11-17(10-14)31-3/h4,9-11,13,15H,1,7-8,12H2,2-3H3,(H2,23,24,25)/t15-/m0/s1 |
InChIKey | KEIPNCCJPRMIAX-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cc(OC)cc(c1)C#Cc2nn([CH]3CCN(C3)C(=O)C=C)c4ncnc(N)c24 | CACTVS 3.385 | COc1cc(OC)cc(c1)C#Cc2nn([C@H]3CCN(C3)C(=O)C=C)c4ncnc(N)c24 | ACDLabs 12.01 | COc1cc(OC)cc(c1)C#Cc3c2c(ncnc2N)n(n3)C4CN(CC4)C([C@H]=C)=O | OpenEye OEToolkits 2.0.6 | COc1cc(cc(c1)OC)C#Cc2c3c(ncnc3n(n2)[C@H]4CCN(C4)C(=O)C=C)N | OpenEye OEToolkits 2.0.6 | COc1cc(cc(c1)OC)C#Cc2c3c(ncnc3n(n2)C4CCN(C4)C(=O)C=C)N |
|
Formula | C22 H22 N6 O3 |
Name | 1-[(3S)-3-{4-amino-3-[(3,5-dimethoxyphenyl)ethynyl]-1H-pyrazolo[3,4-d]pyrimidin-1-yl}pyrrolidin-1-yl]prop-2-en-1-one |
ChEMBL | CHEMBL3701238 |
DrugBank | DB15149 |
ZINC | ZINC000207800318
|
PDB chain | 6mzw Chain A Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|