Structure of PDB 6mk2 Chain A Binding Site BS01 |
|
|
Ligand ID | JUV |
InChI | InChI=1S/C18H16O6/c19-14-6-1-12(2-7-14)5-10-17(21)24-16(18(22)23)11-13-3-8-15(20)9-4-13/h1-10,16,19-20H,11H2,(H,22,23)/b10-5+/t16-/m1/s1 |
InChIKey | LVPGCTXCBGXZHO-ZWIJEDICSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)[C@@H](Cc1ccc(O)cc1)OC(=O)/C=C/c2ccc(O)cc2 | CACTVS 3.385 | OC(=O)[CH](Cc1ccc(O)cc1)OC(=O)C=Cc2ccc(O)cc2 | OpenEye OEToolkits 2.0.6 | c1cc(ccc1CC(C(=O)O)OC(=O)C=Cc2ccc(cc2)O)O | OpenEye OEToolkits 2.0.6 | c1cc(ccc1C[C@H](C(=O)O)OC(=O)/C=C/c2ccc(cc2)O)O | ACDLabs 12.01 | c2cc([C@H]=[C@H]C(=O)OC(C(O)=O)Cc1ccc(cc1)O)ccc2O |
|
Formula | C18 H16 O6 |
Name | (2R)-3-(4-hydroxyphenyl)-2-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}propanoic acid; 4-coumaroyl-(R)-3-(4-hydroxyphenyl)lactate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013526436
|
PDB chain | 6mk2 Chain A Residue 800
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.3.1.140: rosmarinate synthase. |
|
|
|