Structure of PDB 6l89 Chain A Binding Site BS01 |
|
|
Ligand ID | E7C |
InChI | InChI=1S/C24H24O7/c1-14(2)4-6-17-12-15(5-11-19(17)26)13-24(23(29)30-3)20(21(27)22(28)31-24)16-7-9-18(25)10-8-16/h4-5,7-12,25-27H,6,13H2,1-3H3/t24-/m1/s1 |
InChIKey | NGOLMNWQNHWEKU-XMMPIXPASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COC(=O)[C]1(Cc2ccc(O)c(CC=C(C)C)c2)OC(=O)C(=C1c3ccc(O)cc3)O | OpenEye OEToolkits 2.0.7 | CC(=CCc1cc(ccc1O)C[C@@]2(C(=C(C(=O)O2)O)c3ccc(cc3)O)C(=O)OC)C | OpenEye OEToolkits 2.0.7 | CC(=CCc1cc(ccc1O)CC2(C(=C(C(=O)O2)O)c3ccc(cc3)O)C(=O)OC)C | CACTVS 3.385 | COC(=O)[C@]1(Cc2ccc(O)c(CC=C(C)C)c2)OC(=O)C(=C1c3ccc(O)cc3)O |
|
Formula | C24 H24 O7 |
Name | methyl (2R)-3-(4-hydroxyphenyl)-2-[[3-(3-methylbut-2-enyl)-4-oxidanyl-phenyl]methyl]-4-oxidanyl-5-oxidanylidene-furan-2-carboxylate; Butyrolactone I |
ChEMBL | CHEMBL517026 |
DrugBank | |
ZINC | ZINC000027415691
|
PDB chain | 6l89 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|